A0705112
Z-D-Ala-OH , 96% , 26607-51-2
CAS NO.：26607-51-2
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00063126
EINECS: 206-418-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100g | RMB179.20 | In Stock |
|
| 500g | RMB780.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-84°C |
| Boiling point: | 422.1±38.0 °C(Predicted) |
| Density | 1.246±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | 4.00±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| BRN | 2056163 |
| InChI | InChI=1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14)/t8-/m1/s1 |
| InChIKey | TYRGLVWXHJRKMT-MRVPVSSYSA-N |
| SMILES | C(O)(=O)[C@@H](C)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 26607-51-2(CAS DataBase Reference) |
Description and Uses
N-Cbz-D-alanine is the Cbz-protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells.
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
