A0953412
Azoxymethane , 95% , 25843-45-2
Synonym(s):
AOM
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB2503.20 | In Stock |
|
| 100MG | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 97-99 °C (lit.) |
| Density | 0.991 g/mL at 25 °C (lit.) |
| refractive index | 1.4368 (estimate) |
| Flash point: | 24 °C |
| storage temp. | -20°C |
| solubility | Soluble in water, ethanol, and ether |
| form | Liquid |
| Specific Gravity | 0.991 |
| color | Oil |
| InChI | InChI=1S/C2H6N2O/c1-3-4(2)5/h1-2H3 |
| InChIKey | DGAKHGXRMXWHBX-UHFFFAOYSA-N |
| SMILES | [N+]([O-])(C)=NC |
| EPA Substance Registry System | Azoxymethane (25843-45-2) |
Description and Uses
Azoxymethane (AOM), a gene mutation agent, may be used with dextran sulfate sodium (DSS) to create cancer models in laboratory animals which can be used to study mechanisms of cancer progression and chemoprevention.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H300-H315-H319-H350 |
| Precautionary statements | P201-P202-P210-P301+P310-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 45-46-10-25-34-36/38 |
| Safety Statements | 53-26-36/37/39-45 |
| RIDADR | UN 1992 3/PG 3 |
| WGK Germany | 3 |
| RTECS | PA2975000 |
| Toxicity | mma-sat 13,600 mmol/L/20M CNREA8 38,4585,78 |
