A1059150
Di(N-succinimidyl)adipate , 95% , 59156-70-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB317.60 | In Stock |
|
| 1g | RMB805.60 | In Stock |
|
| 5g | RMB1303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-164℃ (ethanol acetonitrile ) |
| Boiling point: | 495.3±55.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Storage temp. -20°C |
| solubility | Soluble in DMSO, DMF, Acetonitrile |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C14H16N2O8/c17-9-5-6-10(18)15(9)23-13(21)3-1-2-4-14(22)24-16-11(19)7-8-12(16)20/h1-8H2 |
| InChIKey | LZZXZDMVRZJZST-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCC(ON1C(=O)CCC1=O)=O |
Description and Uses
Di(N-succinimidyl)adipate contains two NHS ester groups which can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules.
Di(N-succinimidyl)adipate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1].
