A1227412
2,2'-Biisonicotinic Acid , 96% , 6813-38-3
Synonym(s):
(2,5-Di-9H-carbazol-9-ylphenyl)-4-pyridinylmethanone;2,2′-Bipyridyl-4,4′-dicarboxylic acid
CAS NO.:6813-38-3
Empirical Formula: C12H8N2O4
Molecular Weight: 244.2
MDL number: MFCD00015430
EINECS: 626-224-4
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB35.20 | In Stock |
|
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB189.60 | In Stock |
|
| 25G | RMB622.40 | In Stock |
|
| 100G | RMB2135.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >310°C |
| Boiling point: | 387.12°C (rough estimate) |
| Density | 1.3468 (rough estimate) |
| refractive index | 1.6360 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 1.67±0.10(Predicted) |
| color | White to white-gray |
| Water Solubility | insoluble |
| BRN | 212894 |
| InChI | InChI=1S/C12H8N2O4/c15-11(16)7-1-3-13-9(5-7)10-6-8(12(17)18)2-4-14-10/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | FXPLCAKVOYHAJA-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C(O)=O)=C2)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 6813-38-3(CAS DataBase Reference) |
Description and Uses
2,2'-Bipyridine-4,4'-dicarboxylic acid can be used as an organic chemical synthesis intermediate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



