A1246012
α-Bromo-γ-butyrolactone , 97% , 5061-21-2
Synonym(s):
2-Bromo-4-hydroxybutyric acid γ-lactone
CAS NO.：5061-21-2
Empirical Formula: C4H5BrO2
Molecular Weight: 164.99
MDL number: MFCD00005387
EINECS: 225-764-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB179.20 | In Stock |
|
| 500G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 138 °C/6 mmHg (lit.) |
| Density | 1.786 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Acetone, Chloroform, Ethyl Acetate, Methanol |
| form | Clear Colourless to Light Yellow Liquid |
| Specific Gravity | 1.778 (20/4℃) |
| Sensitive | Moisture Sensitive/Lachrymatory |
| BRN | 107800 |
| InChI | InChI=1S/C4H5BrO2/c5-3-1-2-7-4(3)6/h3H,1-2H2 |
| InChIKey | LFJJGHGXHXXDFT-UHFFFAOYSA-N |
| SMILES | O1CCC(Br)C1=O |
| CAS DataBase Reference | 5061-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2(3H)-Furanone, 3-bromodihydro-(5061-21-2) |
| EPA Substance Registry System | 2(3H)-Furanone, 3-bromodihydro- (5061-21-2) |
Description and Uses
Lactams inhibit type Q arylesterase activity of human serum paraoxonase PON1.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Irritant/Keep Cold/Lachrymatory/Moisture Sensitive |
| TSCA | Yes |
| HS Code | 29322980 |
