A1453212
5-Bromoacetyl-2-hydroxybenzamide , 95% , 73866-23-6
CAS NO.：73866-23-6
Empirical Formula: C9H8BrNO3
Molecular Weight: 258.07
MDL number: MFCD00792456
EINECS: 277-626-8
| Pack Size | Price | Stock | Quantity |
| 10G | RMB64.80 | In Stock |
|
| 50G | RMB231.20 | In Stock |
|
| 250G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-210°C |
| Boiling point: | 420.2±40.0 °C(Predicted) |
| Density | 1.705±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 6.13±0.20(Predicted) |
| form | Solid |
| color | Pale Beige to Brown |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C9H8BrNO3/c10-4-8(13)5-1-2-7(12)6(3-5)9(11)14/h1-3,12H,4H2,(H2,11,14) |
| InChIKey | VXWSXLSUWGZOHD-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC(C(CBr)=O)=CC=C1O |
| CAS DataBase Reference | 73866-23-6(CAS DataBase Reference) |
Description and Uses
5-Bromoacetyl-2-hydroxybenzamide is a reagent used in the synthesis of bisthiazole derivatives and novel 7-methylguanine derivatives targeting influenza polymerase binding domains.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RTECS | CV2365900 |
