A1475012
3,5-Bis(trifluoromethyl)benzenesulfonyl chloride , >98.0%(GC)(T) , 39234-86-1
CAS NO.：39234-86-1
Empirical Formula: C8H3ClF6O2S
Molecular Weight: 312.62
MDL number: MFCD00014725
EINECS: 254-371-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C(lit.) |
| Boiling point: | 70°C 2mm |
| Density | 1.618±0.06 g/cm3(Predicted) |
| Flash point: | 228 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Orange to Green |
| Sensitive | Hygroscopic |
| BRN | 3621218 |
| InChI | InChI=1S/C8H3ClF6O2S/c9-18(16,17)6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 39234-86-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride(39234-86-1) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Hygroscopic |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
