![Benzyltrimethylammonium Tribromide [Brominating Reagent]](https://img.chemicalbook.com/CAS/GIF/111865-47-5.gif)
A1537812
Benzyltrimethylammonium Tribromide [Brominating Reagent] , >97.0%(T) , 111865-47-5
Synonym(s):
Benzyltrimethylammonium bromide dibromide;BTMABr3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB169.60 | In Stock |
|
| 500G | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-101 °C (lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | Yellow to orange |
| Sensitive | Hygroscopic |
| BRN | 7105839 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C10H16N.Br3/c1-11(2,3)9-10-7-5-4-6-8-10;1-3-2/h4-8H,9H2,1-3H3;/q+1;-1 |
| InChIKey | UZUKVMLVILGNPX-UHFFFAOYSA-K |
| SMILES | [Br-](Br)Br.C(C1C=CC=CC=1)[N+](C)(C)C |
| CAS DataBase Reference | 111865-47-5(CAS DataBase Reference) |
Description and Uses
Benzyltrimethylammonium Tribromide acts as a brominating agent for aromatic compounds, and also functions as a mild oxidising agent for many functional groups.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HS Code | 29239000 |
