A2262412
Cryptotanshinone , Analysis of standard products, ≥98% , 35825-57-1
Synonym(s):
(R)-(−)-1,6,6-Trimethyl-1,2,6,7,8,9-hexahydrophenanthro[1,2-b]furan-10,11-dione;1,2,6,7,8,9-hexahydro-1,6,6-trimethyl- (R)-phenanthro(1,2-b)furan-10,11-dione;AMPK Signaling Activator VIII;Cryptotanshinon;Tanshinone C
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB86.40 | In Stock |
|
| 50mg | RMB166.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192°C(lit.) |
| Boiling point: | 459.0±45.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥5mg/mL |
| form | powder |
| color | orange-brown |
| optical activity | [α]/D -85.0±3.0°, c = 0.1 in chloroform |
| λmax | 263nm(lit.) |
| BRN | 5445400 |
| InChI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | IJSBKZLSTIFYIE-FPKDZHNTSA-N |
| SMILES | O1C[C@H](C)C2C(=O)C(=O)C3=C(C1=2)C=CC1=C3CCCC1(C)C |
| LogP | 4.130 (est) |
| CAS DataBase Reference | 35825-57-1(CAS DataBase Reference) |
Description and Uses
Cryptotanshinone (CPT), a lipophilic diterpene derived from the roots of Salvia miltiorrhiza Bge and Salvia przewalskii Maxim, may be used to study its multiple bioactivities as an antibacterial, antidermatophytic, antioxidant, anti-inflammatory and anticancer agent. Cryptotanshinone may also be studied as a differentiation factor.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P273-P301+P310-P501 |
| Hazard Codes | T,N |
| Risk Statements | 25-50/53 |
| Safety Statements | 45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | 3 |
| RTECS | SF8282645 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29321900 |
