A2303612
(S)-(+)-3-Chloro-1,2-propanediol , 97% , 60827-45-4
Synonym(s):
(S)-α-Glycerol chlorohydrin
CAS NO.：60827-45-4
Empirical Formula: C3H7ClO2
Molecular Weight: 110.54
MDL number: MFCD00210270
EINECS: 612-041-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB129.60 | In Stock |
|
| 500G | RMB595.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 213 °C(lit.) |
| Density | 1.322 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Completely miscible in water |
| form | clear liquid |
| pka | 13.28±0.20(Predicted) |
| color | very deep yellow |
| BRN | 2202929 |
| InChI | InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2/t3-/m1/s1 |
| InChIKey | SSZWWUDQMAHNAQ-GSVOUGTGSA-N |
| SMILES | C(O)[C@H](O)CCl |
| CAS DataBase Reference | 60827-45-4(CAS DataBase Reference) |
Description and Uses
(S)-3-Chloro-1,2-propanediol is a reagent used for the synthesis of S1P receptor 1 agonist ACT-334441. It is also used to synthesize and characterize chiral PEDOT enantiomers.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H318 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 21-25-41-68-62-36/37/38-23/25 |
| Safety Statements | 26-28-39-45-36/37/39 |
| RIDADR | UN 2689 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TY4202300 |
| F | 3-10 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29055900 |
