A2635512
Coumarin 153 , >98.0%(HPLC) , 53518-18-6
Synonym(s):
2,3,6,7-Tetrahydro-9-(trifluoromethyl)-1H,5H,11H-[1]benzopyrano(6,7,8-ij)quinolizin-11-one;2,3,6,7-Tetrahydro-9-trifluoromethyl-1H,5H-quinolizino(9,1-gh)coumarin;8-Trifluoromethyl-2,3,5,6-4H-1,H-11-oxa-3a-aza-benzo[de]anthracen-10-one;Coumarin 540A
CAS NO.：53518-18-6
Empirical Formula: C16H14F3NO2
Molecular Weight: 309.28
MDL number: MFCD00041843
EINECS: 258-600-5
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB530.40 | In Stock |
|
| 1G | RMB1823.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-168 °C(lit.) |
| Boiling point: | 447.3±45.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 5.16±0.40(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| λmax | 422 nm (lit.) 422 nm |
| BRN | 3624201 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C16H14F3NO2/c17-16(18,19)12-8-13(21)22-15-10-4-2-6-20-5-1-3-9(14(10)20)7-11(12)15/h7-8H,1-6H2 |
| InChIKey | VSSSHNJONFTXHS-UHFFFAOYSA-N |
| SMILES | C12=C3OC(=O)C=C(C(F)(F)F)C3=CC3=C1N(CCC3)CCC2 |
| EPA Substance Registry System | 1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizin-11-one, 2,3,6,7-tetrahydro-9-(trifluoromethyl)- (53518-18-6) |
Description and Uses
Laser dye.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29322010 |
