A2955856
2,4-Dihydro-4-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one , 98% , 106461-41-0
CAS NO.:106461-41-0
Empirical Formula: C22H27N5O2
Molecular Weight: 393.48
MDL number: MFCD02093087
EINECS: 434-820-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB151.20 | In Stock |
|
| 100g | RMB519.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179°C |
| Boiling point: | 587.9±60.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.18±0.30(Predicted) |
| color | Off-White Pale Brown |
| InChI | InChI=1S/C22H27N5O2/c1-3-17(2)27-22(29)26(16-23-27)20-6-4-18(5-7-20)24-12-14-25(15-13-24)19-8-10-21(28)11-9-19/h4-11,16-17,28H,3,12-15H2,1-2H3 |
| InChIKey | FFAQILVGBAELHN-UHFFFAOYSA-N |
| SMILES | N1=CN(C2=CC=C(N3CCN(C4=CC=C(O)C=C4)CC3)C=C2)C(=O)N1C(C)CC |
| CAS DataBase Reference | 106461-41-0(CAS DataBase Reference) |
Description and Uses
An intermediate in the synthesis of Itraconazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |

![2,4-Dihydro-4-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one](https://img.chemicalbook.com/CAS/GIF/106461-41-0.gif)




