A3157512
N,N'-Dimethylethylenediamine , 97% , 110-70-3
Synonym(s):
1,2-Bis(methylamino)ethane;DMEDA
CAS NO.：110-70-3
Empirical Formula: C4H12N2
Molecular Weight: 88.15
MDL number: MFCD00008290
EINECS: 203-793-3
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB67.20 | In Stock |
|
| 25ML | RMB229.60 | In Stock |
|
| 100ML | RMB675.20 | In Stock |
|
| 500ml | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1.63°C (estimate) |
| Boiling point: | 119 °C(lit.) |
| Density | 0.819 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 83 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Miscible with chloroform and dichloromethane. |
| form | Liquid |
| pka | 10.54±0.10(Predicted) |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 0.828 |
| Sensitive | Air Sensitive |
| BRN | 878142 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| LogP | -0.620 |
| CAS DataBase Reference | 110-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA Substance Registry System | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
Description and Uses
Has a DNA binding effect
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 10-34-20/21/22 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2734 8/PG 2 |
| WGK Germany | 3 |
| RTECS | KV4250000 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29212900 |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
