A3208712
Diphenylcarbazide , >98.0%(HPLC) , 140-22-7
Synonym(s):
1,5-Diphenylcarbazide;1,5-Diphenylcarbohydrazide;DPC;sym.-Diphenylcarbazide
CAS NO.:140-22-7
Empirical Formula: C13H14N4O
Molecular Weight: 242.28
MDL number: MFCD00003013
EINECS: 205-403-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-175 °C(lit.) |
| Boiling point: | 385.1°C (rough estimate) |
| bulk density | 420kg/m3 |
| Density | 1.31 g/cm3 |
| refractive index | 1.6120 (estimate) |
| storage temp. | 2-8°C |
| solubility | aqueous acetone: passes test |
| form | Powder or Flakes |
| pka | 9.98±0.43(Predicted) |
| color | White to cream |
| Odor | Odorless |
| Water Solubility | Soluble in glacial acetic acid, alcohol and acetone. Slightly soluble in water. |
| Sensitive | Light Sensitive |
| Merck | 14,3321 |
| BRN | 752039 |
| Stability: | Stable. Light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C13H14N4O/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14-15H,(H2,16,17,18) |
| InChIKey | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| SMILES | O=C(NNc1ccccc1)NNc2ccccc2 |
| CAS DataBase Reference | 140-22-7(CAS DataBase Reference) |
| NIST Chemistry Reference | N'',n'''-diphenylcarbonohydrazide(140-22-7) |
| EPA Substance Registry System | Carbonic dihydrazide, 2,2'-diphenyl- (140-22-7) |
Description and Uses
1,5-Diphenylcarbazide is used in the colorimetric determination of chromium, osmium as well as in the detection of cadmium, mercury, magnesium, emetine and aldehydes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | FF2750000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |





