A3843612
5,6-Diamino-1,10-phenanthroline , 96% , 168646-54-6
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB47.20 | In Stock |
|
| 100MG | RMB78.40 | In Stock |
|
| 250mg | RMB159.20 | In Stock |
|
| 500mg | RMB295.20 | In Stock |
|
| 1g | RMB554.40 | In Stock |
|
| 5g | RMB2396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-156 °C |
| Boiling point: | 492.7±40.0 °C(Predicted) |
| Density | 1.414±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| pka | 5.78±0.10(Predicted) |
| color | Light yellow to yellow |
| InChI | InChI=1S/C12H10N4/c13-9-7-3-1-5-15-11(7)12-8(10(9)14)4-2-6-16-12/h1-6H,13-14H2 |
| InChIKey | MNXMBMNXSPNINS-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(N)C(N)=C3C=2N=CC=C3)C=CC=1 |
Description and Uses
5,6-Diamino-1,10-phenanthroline can be used as ligands for metal ions for drug synthesis[1].
