PRODUCT Properties
| Melting point: | 34-35.5°C |
| Boiling point: | 149-149.8°C (12 mmHg) |
| Density | 0.9900 (estimate) |
| refractive index | 1.5790 (estimate) |
| Flash point: | >110°C |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Light yellow to yellow Solid |
| BRN | 1904973 |
| InChI | InChI=1S/C14H14/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | SRQOBNUBCLPPPH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(CC)C=C1 |
| CAS DataBase Reference | 5707-44-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Ethylbiphenyl(5707-44-8) |
| EPA Substance Registry System | 1,1'-Biphenyl, 4-ethyl- (5707-44-8) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Safety Statements | 24/25 |
| RIDADR | 3077 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29029090 |
