A4054812
Ethyl 2-Bromothiazole-4-carboxylate , >95.0%(GC) , 100367-77-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB310.40 | In Stock |
|
| 100g | RMB1037.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-71 °C |
| Boiling point: | 154°C/13mmHg(lit.) |
| Density | 1.654±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.50±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C6H6BrNO2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3 |
| InChIKey | CNHISCQPKKGDPO-UHFFFAOYSA-N |
| SMILES | S1C=C(C(OCC)=O)N=C1Br |
| CAS DataBase Reference | 100367-77-9(CAS DataBase Reference) |
Description and Uses
Ethyl 2-bromothiazole-4-carboxylate is an essential organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 4-Thiazolecarboxylic acid, Ethyl thiazole-4-carboxylate， 2-Bromothiazole-4-carboxylic acid and so on.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29341000 |
