A4057712
Ethyl 4-Oxocyclohexanecarboxylate , >98.0%(GC) , 17159-79-4
Synonym(s):
4-(Ethoxycarbonyl)cyclohexanone;Ethyl cyclohexanone-4-carboxylate
CAS NO.：17159-79-4
Empirical Formula: C9H14O3
Molecular Weight: 170.21
MDL number: MFCD00013285
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB107.20 | In Stock |
|
| 100G | RMB396.00 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-226 °C |
| Boiling point: | 150-152 °C/40 mmHg (lit.) |
| Density | 1.068 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.07 |
| Water Solubility | insoluble |
| BRN | 2520501 |
| InChI | InChI=1S/C9H14O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7H,2-6H2,1H3 |
| InChIKey | ZXYAWONOWHSQRU-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CCC(=O)CC1 |
| CAS DataBase Reference | 17159-79-4(CAS DataBase Reference) |
Description and Uses
Employed in the preparation of dopamine agonists and the skeleton of tetracyclic diterpenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
