A4305812
9-Fluorenylmethyl carbamate , 99% , 84418-43-9
Synonym(s):
Fmoc-amide
CAS NO.：84418-43-9
Empirical Formula: C15H13NO2
Molecular Weight: 239.27
MDL number: MFCD00237376
EINECS: 805-109-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB173.60 | In Stock |
|
| 100G | RMB538.40 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-204 °C |
| Boiling point: | 459.7±14.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3(Predicted) |
| Flash point: | Not applicable |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | dioxane: 15 mg/mL, clear, colorless |
| pka | 13.06±0.50(Predicted) |
| form | solid |
| color | Clear colorless to yellow |
| BRN | 4188192 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C15H13NO2/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H2,16,17) |
| InChIKey | ZZOKVYOCRSMTSS-UHFFFAOYSA-N |
| SMILES | C1(COC(=O)N)C2C=CC=CC=2C2C=CC=CC1=2 |
| CAS DataBase Reference | 84418-43-9(CAS DataBase Reference) |
Description and Uses
Reagent for the introduction of the Fmoc-group
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Storage Class | 13 - Non Combustible Solids |
