A4385112
3'-Fluoropropiophenone , >97.0%(GC) , 455-67-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB196.80 | In Stock |
|
| 100g | RMB616.00 | In Stock |
|
| 500g | RMB1924.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21 °C |
| Boiling point: | 94-96°C 5mm |
| Density | 1.074±0.06 g/cm3(Predicted) |
| refractive index | 1.505 |
| Flash point: | 94-96°C/5mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Clear Colourless |
| FreezingPoint | 19.0 to 23.0 ℃ |
| BRN | 1936731 |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI | InChI=1S/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| InChIKey | RPMOHVRRKYJFSB-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC(F)=C1)(=O)CC |
| CAS DataBase Reference | 455-67-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Fluoropropiophenone(455-67-4) |
Description and Uses
Bupropion (B689625) intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36-37-23 |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
