A4606612
Guanidine Phosphate , 98% , 5423-23-4
CAS NO.：5423-23-4
Empirical Formula: CH8N3O4P
Molecular Weight: 157.07
MDL number: MFCD00039131
EINECS: 226-552-4
| Pack Size | Price | Stock | Quantity |
| 100G | RMB33.60 | In Stock |
|
| 500G | RMB88.80 | In Stock |
|
| 2.5kg | RMB377.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-250 °C (dec.) |
| Density | 1.48 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 250g/L at 20℃ |
| InChI | InChI=1S/CH5N3.H3O4P/c2-1(3)4;1-5(2,3)4/h(H5,2,3,4);(H3,1,2,3,4) |
| InChIKey | CEDDGDWODCGBFQ-UHFFFAOYSA-N |
| SMILES | C(N)(N)=N.P(O)(O)(O)=O |
| LogP | -3.48 at 25℃ |
| CAS DataBase Reference | 5423-23-4(CAS DataBase Reference) |
Description and Uses
Guanidine Phosphate can be used as flame retardant, water repellent and rust inhibitor for wood, fiber, paper, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H412 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P273-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/22-36/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| HS Code | 2925.29.9000 |
