A4612112
Glycine methyl ester hydrochloride , 99% , 5680-79-5
CAS NO.：5680-79-5
Empirical Formula: C3H8ClNO2
Molecular Weight: 125.55
MDL number: MFCD00012870
EINECS: 227-139-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB62.40 | In Stock |
|
| 500G | RMB172.00 | In Stock |
|
| 2.5kg | RMB732.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.)(lit.) |
| Density | 1.000 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | >1000 g/L (20°C) |
| form | Powder or Cyrstals |
| color | White |
| Water Solubility | >1000 g/L (20 ºC) |
| Sensitive | Hygroscopic |
| BRN | 3593644 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C3H7NO2.ClH/c1-6-3(5)2-4;/h2,4H2,1H3;1H |
| InChIKey | COQRGFWWJBEXRC-UHFFFAOYSA-N |
| SMILES | C(=O)(OC)CN.Cl |
Description and Uses
A Glycine ester, a non-essential amino acid for human development.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224995 |
