A4627312
Boc-Glu-OtBu , 98% , 24277-39-2
Synonym(s):
Boc-L -glutamic acid 1-tert-butyl ester;Boc-Glu-OtBu;N-α-t.-Boc-L-glutamic acid α-t.-butyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB262.40 | In Stock |
|
| 100g | RMB735.20 | In Stock |
|
| 500g | RMB2895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111.0 to 115.0 °C |
| Boiling point: | 449.8±40.0 °C(Predicted) |
| Density | 1.121±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in dimethyl formamide. |
| pka | 4.48±0.10(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| optical activity | -30.8554° (C=1.0042 g/100ml, MEOH) |
| BRN | 3653769 |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)20-11(18)9(7-8-10(16)17)15-12(19)21-14(4,5)6/h9H,7-8H2,1-6H3,(H,15,19)(H,16,17)/t9-/m0/s1 |
| InChIKey | YMOYURYWGUWMFM-VIFPVBQESA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](CCC(O)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 24277-39-2(CAS DataBase Reference) |
Description and Uses
Boc-Glu-OtBu is an N-terminal protected amino acid used in solid-phase peptide synthesis (SPPS) to make unique peptides containing glutamate tert-butyl ester residues.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 22/22-36/37/38 |
| Safety Statements | 4-7-28-35-44 |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
