A4700112
p-hydroxybenzoic acid monosodium salt , 98% , 114-63-6
Synonym(s):
4-Hydroxybenzoic acid sodium salt;Sodium p-hydroxybenzoate
CAS NO.:114-63-6
Empirical Formula: C7H5NaO3
Molecular Weight: 160.1
MDL number: MFCD00016530
EINECS: 204-051-1
| Pack Size | Price | Stock | Quantity |
| 25g | RMB48.00 | In Stock |
|
| 100G | RMB83.20 | In Stock |
|
| 500g | RMB2368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to light beige |
| Water Solubility | Soluble in water. |
| BRN | 4163553 |
| InChI | InChI=1S/C7H6O3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 |
| InChIKey | ZLVSYODPTJZFMK-UHFFFAOYSA-M |
| SMILES | C1(C=CC(O)=CC=1)C([O-])=O.[Na+] |
| CAS DataBase Reference | 114-63-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-hydroxy-, monosodium salt (114-63-6) |
Description and Uses
It is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | DH2900000 |
| F | 3 |
| TSCA | Yes |
| HS Code | 29182900 |
| Toxicity | mouse,LD50,intravenous,1200mg/kg (1200mg/kg),Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 45, Pg. 260, 1956. |



