A4708712
6-Heptynoic acid , 97% , 30964-00-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| 100g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22°C |
| Boiling point: | 93-94 °C/1 mmHg (lit.) |
| Density | 0.997 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with dimethylformamide. |
| pka | 4.69±0.10(Predicted) |
| form | Oil |
| color | Colourless to Light Yellow |
| BRN | 1747024 |
| InChI | InChI=1S/C7H10O2/c1-2-3-4-5-6-7(8)9/h1H,3-6H2,(H,8,9) |
| InChIKey | OFCPMJGTZUVUSM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC#C |
Description and Uses
6-Heptynoic acid is used as a precursor for the the preparation of boradiazaindacenes (BODIPY dyes) by reacting with oxalylchloirde. It is used to prepare 4,4-difluoro-8-(hept-6-yne)-3,5-di(2-(4-methoxyphenyl))-4-bora-3a,4a-diaza-sindacene by reacting with 2-(4-methoxyphenyl)-1H-pyrrole.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 8 |
| HS Code | 29161900 |
