PRODUCT Properties
| Melting point: | 186 °C |
| Boiling point: | 353.48°C (rough estimate) |
| Density | 1.093 |
| refractive index | 1.4800 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | 9.80±0.26(Predicted) |
| form | Solid |
| color | White to Almost white |
| Merck | 14,4701 |
| BRN | 3209460 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1/C18H22O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-20H,3-4H2,1-2H3/t17-,18+ |
| InChIKey | PBBGSZCBWVPOOL-HDICACEKNA-N |
| SMILES | [C@@H](C1=CC=C(O)C=C1)(CC)[C@@H](C1=CC=C(O)C=C1)CC |&1:0,10,r| |
| CAS DataBase Reference | 84-16-2(CAS DataBase Reference) |
Description and Uses
Nonsteroidal synthetic estrogen
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45 |
| Safety Statements | 53-45 |
| WGK Germany | 2 |
| RTECS | SL0560850 |
| HS Code | 2907.29.9000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |
| Hazardous Substances Data | 84-16-2(Hazardous Substances Data) |






