A4801612
1,1,1,3,3,3-Hexafluoroisopropyl Acrylate (stabilized with TBC) , >98.0%(GC) , 2160-89-6
Synonym(s):
HFiPA
CAS NO.：2160-89-6
Empirical Formula: C6H4F6O2
Molecular Weight: 222.09
MDL number: MFCD00040104
EINECS: 218-479-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB495.20 | In Stock |
|
| 100G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84 °C |
| Density | 1.33 g/mL at 25 °C (lit.) |
| vapor pressure | 1.22 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.330 |
| Water Solubility | Insoluble |
| BRN | 2094742 |
| InChI | InChI=1S/C6H4F6O2/c1-2-3(13)14-4(5(7,8)9)6(10,11)12/h2,4H,1H2 |
| InChIKey | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)(=O)C=C |
| CAS DataBase Reference | 2160-89-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Hexafluoroisopropyl acrylate(2160-89-6) |
| EPA Substance Registry System | Hexafluoroisopropyl acrylate (2160-89-6) |
Description and Uses
1,1,1,3,3,3-Hexafluoroisopropyl acrylate is used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335-H411 |
| Precautionary statements | P210-P233-P240-P273-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,N,F |
| Risk Statements | 36/37/38-51/53-11 |
| Safety Statements | 26-28-61-37/39-16 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Flammable/Irritant |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29161290 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
