A4824212
4-Hydrazinobenzenesulfonamide Hydrochloride , >98.0% , 17852-52-7
CAS NO.：17852-52-7
Empirical Formula: C6H10ClN3O2S
Molecular Weight: 223.68
MDL number: MFCD00052262
EINECS: 202-637-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB34.40 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 50g | RMB63.20 | In Stock |
|
| 100G | RMB95.20 | In Stock |
|
| 500g | RMB399.20 | In Stock |
|
| 2.5kg | RMB1735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-152 °C(lit.) |
| Density | 1.644[at 20℃] |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble[in water] |
| solubility | Methanol (Slightly, Heated), Water (Slightly) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H9N3O2S.ClH/c7-9-5-1-3-6(4-2-5)12(8,10)11;/h1-4,9H,7H2,(H2,8,10,11);1H |
| InChIKey | IKEURONJLPUALY-UHFFFAOYSA-N |
| SMILES | C1(S(=O)(=O)N)C=CC(NN)=CC=1.Cl |
| LogP | -0.99 at 20℃ |
| CAS DataBase Reference | 17852-52-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (1:1) (17852-52-7) |
Description and Uses
It is a potentially useful intermediate in the production of Celebrex an anti inflammatory drug.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-24/25 |
| WGK Germany | 3 |
| RTECS | DA9380000 |
| Hazard Note | Irritant |
| HS Code | 29350090 |
