![2-Bromospiro[9H-fluorene-9,9'-[9H]xanthene]](https://img.chemicalbook.com/CAS/20150408/GIF/899422-06-1.gif)
A4867456
2-Bromospiro[9H-fluorene-9,9'-[9H]xanthene] , 98% , 899422-06-1
CAS NO.：899422-06-1
Empirical Formula: C25H15BrO
Molecular Weight: 411.29
MDL number:
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB149.60 | In Stock |
|
| 25g | RMB636.00 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255 °C |
| Boiling point: | 513.8±39.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Gray to Brown |
| InChI | InChI=1S/C25H15BrO/c26-16-13-14-18-17-7-1-2-8-19(17)25(22(18)15-16)20-9-3-5-11-23(20)27-24-12-6-4-10-21(24)25/h1-15H |
| InChIKey | MNBDZJINQUZDFP-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=CC=C3)OC3=C1C=CC=C3)C1=C(C=CC=C1)C1=C2C=C(Br)C=C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29329990 |