A4907212
(2-Hydroxy-phenyl)-acetic acid methyl ester , 98% , 22446-37-3
CAS NO.：22446-37-3
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00090077
EINECS: 245-004-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1G | RMB89.60 | In Stock |
|
| 5G | RMB1119.20 | In Stock |
|
| 10g | RMB1999.20 | In Stock |
|
| 25g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124℃ |
| Boiling point: | 115-120℃ (0.3 Torr) |
| Density | 1.181±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Solid |
| pka | 9.55±0.30(Predicted) |
| color | Off-White to Light Brown |
| InChI | InChI=1S/C9H10O3/c1-12-9(11)6-7-4-2-3-5-8(7)10/h2-5,10H,6H2,1H3 |
| InChIKey | BVBSGGBDFJUSIH-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)=CC=CC=C1O |
Description and Uses
Methyl 2-(2-Hydroxyphenyl)acetate is used as a reactant in the preparation of caffeic acid phenylethyl esters as ?antiproliferative agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| HS Code | 2916399090 |
