Indole-3-carboxylic Acid , 98% , 771-50-6
Synonym(s):
β-Indolylcarboxylic acid;3-Carboxyindole;3-Indole formic acid;3-Indolylcarboxylic acid;Indole-β-carboxylic acid
CAS NO.:771-50-6
Empirical Formula: C9H7NO2
Molecular Weight: 161.16
MDL number: MFCD00005624
EINECS: 212-231-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB217.60 | In Stock |
|
| 500g | RMB758.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 232-234 °C (dec.)(lit.) |
| Boiling point: | 287.44°C (rough estimate) |
| Density | 1.2480 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in 95% Ethanol: 50 mg/ml, also soluble in methanol. |
| form | Powder |
| pka | 3.90±0.10(Predicted) |
| color | Light beige |
| BRN | 129435 |
| InChI | InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12) |
| InChIKey | KMAKOBLIOCQGJP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=C1 |
| CAS DataBase Reference | 771-50-6(CAS DataBase Reference) |
Description and Uses
Indole-3-carboxylic acid is a plant metabolite derived from tryptophan that has been found in Arabidopsis and has diverse biological activities.1,2,3,4 It induces resistance in Arabidopsis against the plant necrotrophic fungus P. cucumerina when applied as a soil-drenching solution at a concentration of 150 µM prior to infection.2 Indole-3-carboxylic acid is cytotoxic to A549 human lung and MCF-7 human breast cancer cells (EC50s = 4.6 and 12.9 µg/ml, respectively) and inhibits HIV replication in infected H9 lymphocytes (IC50 = 16.4 µg/ml).3 Indole-3-carboxylic acid has also been used as a precursor in the synthesis of substituted thiadiazoles with anticancer activity.4WARNING This product is not for human or veterinary use.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | NK7882892 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |





