A5214012
Isopropyl benzenesulfonate , 97% , 6214-18-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB29.60 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 25g | RMB336.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 155 °C(Press: 7 Torr) |
| Density | 1.145 g/cm3 |
| RTECS | DB7151080 |
| refractive index | 1.5020 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and ethyl acetate. |
| form | Liquid |
| color | Colorless to pale yellow |
| InChI | InChI=1S/C9H12O3S/c1-8(2)12-13(10,11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | YQZZXXKFKTWDPY-UHFFFAOYSA-N |
| SMILES | C1(S(OC(C)C)(=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 6214-18-2 |
Description and Uses
A sulfonate ester that acts as a potential effects in drug substances impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2904100090 |
