A5263512
L-Leucine methyl ester hydrochloride , 98% , 7517-19-3
CAS NO.：7517-19-3
Empirical Formula: C7H16ClNO2
Molecular Weight: 181.66
MDL number: MFCD00012494
EINECS: 231-375-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500G | RMB440.00 | In Stock |
|
| 2.5kg | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-153 °C(lit.) |
| alpha | 20 º (c=4.5, MeOH) |
| refractive index | 13 ° (C=2, H2O) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White |
| optical activity | [α]22/D +13°, c = 2 in H2O |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3595133 |
| InChI | InChI=1/C7H15NO2.ClH/c1-5(2)4-6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H/t6-;/s3 |
| InChIKey | DODCBMODXGJOKD-UZHXKHNSNA-N |
| SMILES | [C@H](N)(CC(C)C)C(=O)OC.Cl |&1:0,r| |
| CAS DataBase Reference | 7517-19-3(CAS DataBase Reference) |
Description and Uses
L-Leucine methyl ester is a protected form of L-Leucine (L330110). L-Leucine is an essential amino acid that induces a sharp decrease in blood glucose levels in individuals with idiopathic familial hypoglycemia, but has no known effects on normal, healthy individuals. L-Leucine also acts as an Isoleucine (I820210) antagonist in the rat, causing delays in growth, and is a potential tumour promoter of bladder cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224995 |
