PRODUCT Properties
| Melting point: | 118-121 °C(lit.) |
| Boiling point: | 141.1±23.0 °C(Predicted) |
| Density | 1.095 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble[in water] |
| Water Solubility | Soluble in water |
| pka | 14.98±0.70(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| BRN | 506162 |
| InChI | InChI=1S/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| InChIKey | KQJQICVXLJTWQD-UHFFFAOYSA-N |
| SMILES | N(C)C(N)=S |
| CAS DataBase Reference | 598-52-7(CAS DataBase Reference) |
Description and Uses
N-Methylthiourea can be used as a novel coolant composition for electric vehicle.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H411 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | YT9000000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29309090 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
