A5505812
Methyl isoquinoline-3-carboxylate , 98% , 27104-73-0
CAS NO.：27104-73-0
Empirical Formula: C11H9NO2
Molecular Weight: 187.19
MDL number: MFCD00075138
EINECS: 626-565-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25G | RMB2479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C (lit.) |
| Boiling point: | 321.94°C (rough estimate) |
| Density | 1.1963 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 2.58±0.30(Predicted) |
| Appearance | Off-white to light yellow Solid |
| BRN | 473630 |
| InChI | InChI=1S/C11H9NO2/c1-14-11(13)10-6-8-4-2-3-5-9(8)7-12-10/h2-7H,1H3 |
| InChIKey | ZBCGBIZQNMVMPC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C=C(C(OC)=O)N=1 |
| CAS DataBase Reference | 27104-73-0(CAS DataBase Reference) |
Description and Uses
Methyl 3-isoquinolinecarboxylate was used in the preparation of 3-acetylisoquinoline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
