A5677812
2-Methoxybenzoyl Chloride , >98.0%(GC)(T) , 21615-34-9
Synonym(s):
o-Anisoyl chloride
CAS NO.:21615-34-9
Empirical Formula: C8H7ClO2
Molecular Weight: 170.59
MDL number: MFCD00000664
EINECS: 244-477-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB416.80 | In Stock |
|
| 500G | RMB1109.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 128-129 °C8 mm Hg(lit.) |
| Density | 1.146 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 84 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform |
| form | Liquid |
| color | Clear yellow to brown |
| Sensitive | Moisture Sensitive |
| BRN | 607605 |
| InChI | InChI=1S/C8H7ClO2/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3 |
| InChIKey | RZNHSEZOLFEFGB-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1OC |
| CAS DataBase Reference | 21615-34-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 2-methoxy-(21615-34-9) |
| EPA Substance Registry System | Benzoyl chloride, 2-methoxy- (21615-34-9) |
Description and Uses
2-Methoxybenzoyl chloride has been used in preparation of:
- 2-methoxybenzoyl-ferrocene Friedel Crafts reaction with ferrocene
- 2-methoxybenzoyl phosphate
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1729 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




