A5976312
Methyl 4-(chlorosulfonyl)benzoate , 95% , 69812-51-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1G | RMB112.00 | In Stock |
|
| 5g | RMB347.20 | In Stock |
|
| 25g | RMB1532.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-73℃ |
| Boiling point: | 126 °C(Press: 0.05 Torr) |
| Density | 1.431 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| color | Faint to light orange |
| InChI | InChI=1S/C8H7ClO4S/c1-13-8(10)6-2-4-7(5-3-6)14(9,11)12/h2-5H,1H3 |
| InChIKey | MOFQDKOKODUZPK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 |
Description and Uses
4-(Chlorosulfonyl)-benzoic acid methyl ester can be used as an organic synthesis raw material for the preparation of other heterocyclic compounds.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P301+P330+P331-P304+P340+P310-P305+P351+P338+P310 |
| RIDADR | 3261 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2904990090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
