A6233612
3-Nitro-1，2，4-triazole , ≥98.0%(HPLC) , 24807-55-4
CAS NO.：24807-55-4
Empirical Formula: C2H2N4O2
Molecular Weight: 114.06
MDL number: MFCD00009749
EINECS: 246-468-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB511.20 | In Stock |
|
| 500g | RMB2047.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.)(lit.) |
| Boiling point: | 213.51°C (rough estimate) |
| Density | 1.7897 (rough estimate) |
| refractive index | 1.4164 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Methanol |
| form | Solid |
| pka | 5.92±0.20(Predicted) |
| color | Light Yellow |
| Water Solubility | slightly soluble |
| BRN | 607167 |
| InChI | InChI=1S/C2H2N4O2/c7-6(8)2-3-1-4-5-2/h1H,(H,3,4,5) |
| InChIKey | KUEFXPHXHHANKS-UHFFFAOYSA-N |
| SMILES | N1C([N+]([O-])=O)=NC=N1 |
| CAS DataBase Reference | 24807-55-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-1,2,4-triazole, 3-nitro-(24807-55-4) |
Description and Uses
3-Nitro-1,2,4-triazole is used in oligonucleotide synthesis. Also a radiosensitizer of hypoxic cells in vitro.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 9 |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
