A6477825
4-(4-Nitrophenyl)-3-morpholinone , 98% , 446292-04-2
CAS NO.：446292-04-2
Empirical Formula: C10H10N2O4
Molecular Weight: 222.2
MDL number: MFCD08236741
EINECS: 610-199-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB60.00 | In Stock |
|
| 25g | RMB163.20 | In Stock |
|
| 100g | RMB520.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 516.8±45.0 °C(Predicted) |
| Density | 1.397 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -4.12±0.20(Predicted) |
| form | Solid |
| color | Off-White to Yellow |
| InChI | InChI=1S/C10H10N2O4/c13-10-7-16-6-5-11(10)8-1-3-9(4-2-8)12(14)15/h1-4H,5-7H2 |
| InChIKey | OWMGEFWSGOTGAU-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCOCC1=O |
Description and Uses
4-(4-Nitrophenyl)morpholin-3-one is a nitro compound that has been shown to be magnetic and show an operational chemical formula. It has been studied in techniques such as magnetic resonance imaging (MRI) and X-ray crystallography.
Reagent used in the preparation of various Morpholine based pharmaceuticals. Rivaroxaban Impurity 52.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
