A6489312
Nitroxinil , 97% , 1689-89-0
Synonym(s):
4-Hydroxy-3-iodo-5-nitrobenzonitrile;Nitroxynil
CAS NO.：1689-89-0
Empirical Formula: C7H3IN2O3
Molecular Weight: 290.01
MDL number: MFCD00070776
EINECS: 216-884-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB228.80 | In Stock |
|
| 100g | RMB688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-138° |
| Boiling point: | 280.1±40.0 °C(Predicted) |
| Density | 2.1385 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.00±0.38(Predicted) |
| form | Solid |
| color | Off-white to light yellow |
| InChI | InChI=1S/C7H3IN2O3/c8-5-1-4(3-9)2-6(7(5)11)10(12)13/h1-2,11H |
| InChIKey | SGKGVABHDAQAJO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=C(O)C(I)=C1 |
| CAS DataBase Reference | 1689-89-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Nitroxinil(1689-89-0) |
| EPA Substance Registry System | Nitroxynil (1689-89-0) |
Description and Uses
Nitroxinil is an anthelmintic used in the treatment of liver fluke. Nitroxinil is used for the treatment of fascioliasis in cattle and sheep.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319-H335-H400 |
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-43 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DI4600000 |
| HS Code | 29269090 |
| Toxicity | mammal (species unspecified),LDLo,oral,125mg/kg (125mg/kg),Fortschritte der Arzneimittelforschung. Progress in Drug Research. Vol. 17, Pg. 108, 1973. |
