A6968058
D(-)-Arabinose , 10mMinDMSO , 28697-53-2
CAS NO.：28697-53-2
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00064361
EINECS: 233-708-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164 °C(lit.) |
| alpha | -103.5 º (c=4, H2O, 24hrs.) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.1897 (rough estimate) |
| refractive index | 1.3920 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | Liquid |
| pka | 12.26±0.70(Predicted) |
| color | Clear |
| Water Solubility | soluble |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-ZRMNMSDTSA-N |
| SMILES | OC1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference | 28697-53-2(CAS DataBase Reference) |
Description and Uses
An inhibitor of the enzyme glucose dehydrogenase.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29400090 |
