A7055358
Alloxanmonohydrate , 10mMinDMSO , 2244-11-3
Synonym(s):
2,4,5,6(1H,3H)-Pyrimidinetetrone;2,4,5,6-Tetraoxypyrimidine;5,6-Dioxyuracil
CAS NO.:2244-11-3
Empirical Formula: C4H4N2O5
Molecular Weight: 160.09
MDL number: MFCD00149399
EINECS: 607-078-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | H2O: may be hazy yellow |
| form | Crystalline Powder |
| color | Off-white to beige-yellow |
| Water Solubility | Soluble in water, ethanol, acetone, glacial acetic acid and methanol. Slightly soluble in chloroform, petroleum ether, toluene, ethyl acetate and acetic anhydride. Insoluble in ether. |
| Sensitive | Air Sensitive |
| Merck | 14,282 |
| BRN | 5309394 |
| InChI | InChI=1S/C4H2N2O4.H2O/c7-1-2(8)5-4(10)6-3(1)9;/h(H2,5,6,8,9,10);1H2 |
| InChIKey | DSXMTJRUNLATRP-UHFFFAOYSA-N |
| SMILES | O=C1C(NC(=O)NC1=O)=O.O |
| CAS DataBase Reference | 2244-11-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate (2244-11-3) |
Description and Uses
specific cytotoxin (beta pacreatic cell)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-26-36/37 |
| WGK Germany | 3 |
| RTECS | UW0492000 |
| TSCA | Yes |
| HS Code | 29335995 |






