A7160612
(<i>R</i>)-9-(2-Hydroxypropyl)adenine , >98.0%(HPLC)(T) , 14047-28-0
CAS NO.：14047-28-0
Empirical Formula: C8H11N5O
Molecular Weight: 193.21
MDL number: MFCD07369451
EINECS: 604-188-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 10g | RMB47.20 | In Stock |
|
| 25g | RMB96.00 | In Stock |
|
| 100g | RMB322.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193 °C |
| Boiling point: | 457.7±55.0 °C(Predicted) |
| Density | 1.57 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 14.42±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1/C8H11N5O/c1-5(14)2-13-4-12-6-7(9)10-3-11-8(6)13/h3-5,14H,2H2,1H3,(H2,9,10,11)/t5-/s3 |
| InChIKey | MJZYTEBKXLVLMY-GQMHJJTINA-N |
| SMILES | N1(C[C@@H](C)O)C=NC2C(=NC=NC1=2)N |&1:2,r| |
Description and Uses
(R)-9-[2-(Hydroxypropyl] Adenine (Desphosphoryl Tenofovir) (cas# 14047-28-0) is a useful reagent for preparing the antiviral drug tenofovir.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933.99.8290 |
