PRODUCT Properties
| Melting point: | 225°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water |
| Merck | 14,8771 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H13NO2.ClH/c1-8(2)5-3-4-6(8)7(9)10;/h6H,3-5H2,1-2H3;1H |
| InChIKey | DUNMULOWUUIQIL-UHFFFAOYSA-N |
| SMILES | C1(CCC[N+]1(C)C)C([O-])=O.Cl |
| CAS DataBase Reference | 4136-37-2(CAS DataBase Reference) |
Description and Uses
Stachydrine Chloride is a constituent of the Chinese herb leonurus heterophyllus sweet. its used in clinics to support blood circulation and dispel blood stasis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 20-22 |
| Safety Statements | 22-45-36/37/39 |
| HS Code | 29339900 |
