N-Succinimidyl 6-Biotinamidohexanoate , 98% , 72040-63-2
Synonym(s):
(+)-Biotinamidocaproate N-hydroxysuccinimidyl ester;Biotin-X-NHS, Water-Soluble;N-(+)-Biotinyl-6-aminocaproic acid N-succinimidyl ester;N-(+)-Biotinyl-6-aminohexanoic acid NHS ester;N-Succinimidyl N-biotinyl-6-aminocaproate
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB39.20 | In Stock |
|
| 25MG | RMB118.40 | In Stock |
|
| 100MG | RMB346.40 | In Stock |
|
| 20mg | RMB504.00 | In Stock |
|
| 250mg | RMB604.80 | In Stock |
|
| 500MG | RMB1000.00 | In Stock |
|
| 1g | RMB1521.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 169-171 °C |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: ≤2 mg/mL with sonication |
| form | powder |
| pka | 13.90±0.40(Predicted) |
| color | White to Off-White |
| Appearance | white solid |
| Water Solubility | H2O: ≤2mg/mL (with sonication) DMF: 50mg/mL (Stable up to 2 months in dry DMF.) |
| BRN | 3577403 |
| Stability: | Moisture Sensitive |
| InChIKey | UVGHPGOONBRLCX-NJSLBKSFSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1 |
| CAS DataBase Reference | 72040-63-2(CAS DataBase Reference) |
Description and Uses
Biotin-LC-NHS Ester has an extended spacer arm which helps to minimize steric hindrance. The membrane permeability of this reagent allows it to be used for intracellular labeling. It can react efficiently with primary amino (-NH2) to form stable, irreversible amide bonds.
Succinimidyl 6-(biotinamido)hexanoate is a biotinylation reagent incorporating an aminocaproyl “spacer”. This can reduce the steric hindrance in binding avidin to some biotinylated compounds when used to biotinylate both the antibody and the carrier in the Protein Avidin-Biotin Capture System. This system avoids the direct interaction of a captured antibody with solid surfaces, such as plastics, which may reduce antigenicity. It has also been used to enhance the detection of DNA on nitrocellulose. Has also been used as a cell surface labelling reagent
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |







