A7635712
p-Tolylacetic acid , 99% , 622-47-9
Synonym(s):
4-Methylphenylacetic acid
CAS NO.：622-47-9
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD00004353
EINECS: 210-738-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB84.80 | In Stock |
|
| 500G | RMB356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-92 °C (lit.) |
| Boiling point: | 265-267 °C (lit.) |
| Density | 1.0858 (rough estimate) |
| refractive index | 1.5002 (estimate) |
| Flash point: | 265-267°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | pK1:4.370 (25°C) |
| form | Fine Crystalline Powder |
| color | White |
| BRN | 2043528 |
| InChI | InChI=1S/C9H10O2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | GXXXUZIRGXYDFP-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(C)C=C1 |
| CAS DataBase Reference | 622-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | p-Tolylacetic acid(622-47-9) |
Description and Uses
p-Tolylacetic acid is a reagent used in the preparation of quaternary amines and epithelial sodium channel inhibition in bronchial epithelium.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | AJ7569000 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
