A7712358
Icaritin , 10mMinDMSO , 118525-40-9
Synonym(s):
3,5,7-Trihydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239℃ |
| Boiling point: | 582.0±50.0 °C(Predicted) |
| Density | 1.359 |
| Flash point: | 206.7℃ |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| form | powder |
| pka | 6.44±0.40(Predicted) |
| color | light yellow to dark yellow |
| λmax | 368nm(MeOH)(lit.) |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-9-14-15(22)10-16(23)17-18(24)19(25)20(27-21(14)17)12-5-7-13(26-3)8-6-12/h4-8,10,22-23,25H,9H2,1-3H3 |
| InChIKey | TUUXBSASAQJECY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C=C2)OC2=C(C/C=C(/C)\C)C(O)=CC(O)=C2C(=O)C=1O |
Description and Uses
Icaritin is a hydrolytic product of Icariin, a traditional Chinese herbal medicine extracted from the Epimedium genus. Icaritin and Desmethylicaritin, is two metabolites of Icariin, dramatically inhibit the growth of most malignant cells. They also have significant antiangiogenesis properties, inhibiting or eliminating entirely the development of new malignant cells. Icaritin has been used in trials studying the treatment of Solid Tumors, Metastatic Breast Cancer, and Hepatocellular Carcinoma (HCC).
Safety
| WGK Germany | 3 |
| RTECS | DJ3100870 |
| HS Code | 29329990 |
