A7780212
Tributylmethylammonium Bis(trifluoromethanesulfonyl)imide , 98% , 405514-94-5
Synonym(s):
Methyltributylammonium bis(trifluoromethylsulfonyl)imide;N 4441-TFSI
CAS NO.:405514-94-5
Empirical Formula: C13H30N.C2F6NO4S2
Molecular Weight: 480.532
MDL number: MFCD12761447
| Pack Size | Price | Stock | Quantity |
| 1g | RMB132.80 | In Stock |
|
| 5G | RMB436.80 | In Stock |
|
| 25G | RMB1663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27°C |
| Density | 1.27g/ml |
| refractive index | 1.4260-1.4300 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C13H30N.C2F6NO4S2/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-13H2,1-4H3;/q+1;-1 |
| InChIKey | XALVHDZWUBSWES-UHFFFAOYSA-N |
| SMILES | [N+](C)(CCCC)(CCCC)CCCC.[N-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| ECW | 6.2 V |
Description and Uses
Ionic liquids (ILs) are molten salts with melting points lower than 100 °C. They usually consist of pair of organic cation and anion. ILs exhibit unique properties such as non-volatility, high thermal stability, and high ionic conductivity and find applications as electrolytes in lithium/sodium ion batteries and dye-sensitized solar cells. They are also used as media for synthesis of conducting polymers and intercalation electrode materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 10 - Combustible liquids |







