A7787512
1,2,3-Tri-O-acetyl-5-deoxy-β-D-ribofuranose , 97% , 62211-93-2
CAS NO.:62211-93-2
Empirical Formula: C11H16O7
Molecular Weight: 260.24
MDL number: MFCD08458459
EINECS: 612-957-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500g | RMB585.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-64°C |
| Boiling point: | 315°C |
| alpha | -19.0 to -23.0 deg(C=2, EtOH) |
| Density | 1.23 |
| vapor pressure | 0.005-0.01Pa at 20-25℃ |
| Flash point: | 136°C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in ethanol |
| form | Powder |
| color | Yellow to Brown |
| optical activity | Consistent with structure |
| InChI | InChI=1/C11H16O7/c1-5-9(16-6(2)12)10(17-7(3)13)11(15-5)18-8(4)14/h5,9-11H,1-4H3/t5-,9-,10-,11+/s3 |
| InChIKey | NXEJETQVUQAKTO-QPGVQJSANA-N |
| SMILES | O([C@H]1[C@@H](O[C@H](C)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,4,6,r| |
| LogP | 0.377-0.43 at 25℃ |
| Surface tension | 39.28mN/m at 1.01g/L and 20℃ |
| CAS DataBase Reference | 62211-93-2(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Cepecitabine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29400090 |






