A7880312
1,2,4-Triazolo[4,3-<i>a</i>]pyridin-3(2<i>H</i>)-one , >98.0%(HPLC) , 6969-71-7
Synonym(s):
3-Hydroxytriazolo[4,3-a]pyridine;s-Triazolo[4,3-a]pyridin-3-ol
CAS NO.:6969-71-7
Empirical Formula: C6H5N3O
Molecular Weight: 135.12
MDL number: MFCD00022632
EINECS: 230-191-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB224.80 | In Stock |
|
| 100G | RMB536.80 | In Stock |
|
| 250g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231°C |
| Density | 1.51±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| pka | 7.86±0.20(Predicted) |
| form | Solid |
| color | Light Brown to Brown |
| BRN | 607433 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6H5N3O/c10-6-8-7-5-3-1-2-4-9(5)6/h1-4H,(H,8,10) |
| InChIKey | LJRXNXBFJXXRNQ-UHFFFAOYSA-N |
| SMILES | C12=NNC(=O)N1C=CC=C2 |
| LogP | 0.113 |
| CAS DataBase Reference | 6969-71-7(CAS DataBase Reference) |
Description and Uses
1,2,4-Triazolo[4,3-a]pyridin-3(2H)-one was used to prepare a congener of Trazodone (T718500) which was found to be a potent and selective inhibitor of synaptosomal uptake of 5-hydroxytryptamine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |

![1,2,4-Triazolo[4,3-<i>a</i>]pyridin-3(2<i>H</i>)-one](https://img.chemicalbook.com/CAS/GIF/6969-71-7.gif)

